What are the properties and uses of linoleic acid? Introduction to linoleic acid

[alias]octadeca-9,12-diene, cis-octadeca-9,12-diene acid, dense acid ［molecular formula］c18h32o2 ［structural formula］ch3(ch2)4ch=chch2ch=ch(ch2)7cooh [properties] linoleic acid is an unsaturated higher aliphatic diene acid. the pure product is a colorless liquid and an industrial product. it is light yellow with a relative density of 0.9025 (20℃), a melting point of -5℃, a boiling point of 129℃ (2.67pa), 224℃ (1.333kpa), 228℃…