2-ethyl-1,3-hexanediol 2-ethyl-1,3-hexanediol
structural formula business number 028e molecular formula c8h18o2 molecular weight 146.23 label 2-ethylhexane-1,3-diol, repellent, 2-ethyl-1,3-hexanediol, 2-ethyl-3-hexanediol, 2-ethyl-1,3-hexylene glycol, 2-ethyl-3-propyl-1,3-propanediol, octylene glycol, ethohexadiol, ch3ch2ch2ch(oh)ch(c2h5)ch2oh, mosquito and fly repellent, ink solvent, alcohol solvents, cosmetic raw materials numbering system physical property data toxicological data ecological data molecular structure data computing chemical data more properties and stability storage method…

