
structural formula
| business number | 079b |
|---|---|
| molecular formula | c12h22o2 |
| molecular weight | 198.30 |
| label |
2-ethylhexyl methacrylate, methacrylic acid 2-ethylhexyl ester, methacrylic acid octyl ester, octyl methacrylate, ch2=c(ch3)cooch2ch(c2h5)(ch2)3ch3, aliphatic compounds |
numbering system
cas number:688-84-6
mdl number:mfcd00009494
einecs number:211-708-6
rtecs number:oz4630000
brn number:1769420
pubchem number:24882662
physical property data
1. characteristics: colorless liquid.
2. density (g/ml,25/4℃): 0.885
3. relative vapor density (g/ml,air=1): 6.9
4. melting point (ºc): -50
5. boiling point (ºc,normal pressure): 218
6. boiling point (ºc,5.2kpa): undetermined
7. refractive index: 1.438
8 . flashpoint (ºc): 92
9. specific optical rotation (º): undetermined
10. autoignition point or ignition temperature (ºc): undetermined
11. vapor pressure (kpa,25ºc): undetermined
12. saturated vapor pressure (kpa,60ºc): undetermined
13. heat of combustion (kj/mol): undetermined
14. critical temperature (ºc): undetermined
15. critical pressure (kpa): undetermined
16. oil and water (octanol/logarial value of the partition coefficient of water: undetermined
17. explosion limit (%,v/v): undetermined
18. lower explosion limit (%,v/v): undetermined
19. solubility: not soluble in water.
toxicological data
, acute toxicity: mice ( peritoneum) ld50: 2,614 mg/kg
dog (oral)ld50: 3,250 mg/kg
since the ld50 of table salt is 3,000 mg/kg, bpa has the same degree of acute toxicity as table salt.
ecological data
usually not harmful to water, do not discharge materials into the surrounding environment without government permission.
molecular structure data
1. molar refractive index: 58.94
2. molar volume(m3/mol):225.3
3. isotonic ratio(90.2k):516.8
4. surface tension(dyne/cm):27.6
5. dielectric constant:
6. dipole moment(10-24cm3):
7. polarizability: 23.36
compute chemical data
1. hydrophobic parameters calculate reference value (xlogp): 4.5
2. hydrogen bonding number of donors: 0
3. hydrogen bonding number of receptors: 2
4. rotatable number of chemical bonds: 8
5. topological molecular polar surface area (tpsa): 26.3
6. heavy atoms quantity: 14
7. surface charge :0
8. complexity :185
9. isotope atomic number:0
10. determine the number of atomic stereocenters:0
11. uncertain number of atomic stereocenters:0
12. determine the number of chemical bond stereocenters:0
13. uncertain number of chemical bond stereocenters:0
14. number of covalent bond units: 1
properties and stability
keep away from oxides, acids, alkalis, light, and heat.
storage method
store in an airtight container and place store in a cool, dry place. store away from oxidizing agents. never store together with acidic substances and alkali metals. keep away from light.
synthesis method
none
purpose
none

